About 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid
2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid (PubChem CID 169360263) has the molecular formula C10H7F2N3O2S
and a molecular weight of 271.25 g/mol. Its IUPAC name is 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid |
| PubChem CID | 169360263 |
| Molecular Formula | C10H7F2N3O2S |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid |
| SMILES | CS/C(=N\c1cc(F)c(F)cc1C(=O)O)NC#N |
| InChI | InChI=1S/C10H7F2N3O2S/c1-18-10(14-4-13)15-8-3-7(12)6(11)2-5(8)9(16)17/h2-3H,1H3,(H,14,15)(H,16,17) |
| InChIKey | RVFDJEGPHXCRCG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid?
The IUPAC name of 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid (CID 169360263) is 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid.
What is the SMILES notation for 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid?
The canonical SMILES for 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid is CS/C(=N\c1cc(F)c(F)cc1C(=O)O)NC#N.
What is the InChIKey of 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid?
The InChIKey is RVFDJEGPHXCRCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2N3O2S/c1-18-10(14-4-13)15-8-3-7(12)6(11)2-5(8)9(16)17/h2-3H,1H3,(H,14,15)(H,16,17).
What are the key properties of 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid?
2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid has a molecular weight of 271.25 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-4,5-difluorobenzoic acid is sourced from PubChem (CID 169360263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).