About methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate
methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169360515) has the molecular formula C11H6BrF6N3S
and a molecular weight of 406.15 g/mol. Its IUPAC name is methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate |
| PubChem CID | 169360515 |
| Molecular Formula | C11H6BrF6N3S |
| Molecular Weight | 406.15 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc(C(F)(F)F)cc(C(F)(F)F)c1Br)NC#N |
| InChI | InChI=1S/C11H6BrF6N3S/c1-22-9(20-4-19)21-7-3-5(10(13,14)15)2-6(8(7)12)11(16,17)18/h2-3H,1H3,(H,20,21) |
| InChIKey | DYXRASUTKVWKOL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.15 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate?
The IUPAC name of methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate (CID 169360515) is methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate.
What is the SMILES notation for methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate?
The canonical SMILES for methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate is CS/C(=N\c1cc(C(F)(F)F)cc(C(F)(F)F)c1Br)NC#N.
What is the InChIKey of methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate?
The InChIKey is DYXRASUTKVWKOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6BrF6N3S/c1-22-9(20-4-19)21-7-3-5(10(13,14)15)2-6(8(7)12)11(16,17)18/h2-3H,1H3,(H,20,21).
What are the key properties of methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate?
methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate has a molecular weight of 406.15 g/mol, XLogP of 4.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-[2-bromo-3,5-bis(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate is sourced from PubChem (CID 169360515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).