About methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate
methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169360631) has the molecular formula C18H15ClF3N3OS
and a molecular weight of 413.85 g/mol. Its IUPAC name is methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate.
Molecular Properties
| Compound Name | methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate |
| PubChem CID | 169360631 |
| Molecular Formula | C18H15ClF3N3OS |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc(C(F)(F)F)ccc1Oc1cc(C)c(Cl)c(C)c1)NC#N |
| InChI | InChI=1S/C18H15ClF3N3OS/c1-10-6-13(7-11(2)16(10)19)26-15-5-4-12(18(20,21)22)8-14(15)25-17(27-3)24-9-23/h4-8H,1-3H3,(H,24,25) |
| InChIKey | VBTIFGVRCWYPOR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate?
The IUPAC name of methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate (CID 169360631) is methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate.
What is the SMILES notation for methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate?
The canonical SMILES for methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate is CS/C(=N\c1cc(C(F)(F)F)ccc1Oc1cc(C)c(Cl)c(C)c1)NC#N.
What is the InChIKey of methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate?
The InChIKey is VBTIFGVRCWYPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClF3N3OS/c1-10-6-13(7-11(2)16(10)19)26-15-5-4-12(18(20,21)22)8-14(15)25-17(27-3)24-9-23/h4-8H,1-3H3,(H,24,25).
What are the key properties of methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate?
methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate has a molecular weight of 413.85 g/mol, XLogP of 6.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N'-[2-(4-chloro-3,5-dimethylphenoxy)-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate is sourced from PubChem (CID 169360631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).