C11H12N4OS — CID 169361401
methyl N'-[3-(2-amino-2-oxoethyl)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169361401) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is methyl N'-[3-(2-amino-2-oxoethyl)phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[3-(2-amino-2-oxoethyl)phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169361401 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | methyl N'-[3-(2-amino-2-oxoethyl)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cccc(CC(N)=O)c1)NC#N |
| InChI | InChI=1S/C11H12N4OS/c1-17-11(14-7-12)15-9-4-2-3-8(5-9)6-10(13)16/h2-5H,6H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | GTCWMPUHAOLRHO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|