C13H13F2N3OS — CID 169362435
methyl N-cyano-N'-(4-cyclobutyloxy-3,5-difluorophenyl)carbamimidothioate (PubChem CID 169362435) has the molecular formula C13H13F2N3OS and a molecular weight of 297.33 g/mol. Its IUPAC name is methyl N-cyano-N'-(4-cyclobutyloxy-3,5-difluorophenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(4-cyclobutyloxy-3,5-difluorophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169362435 |
| Molecular Formula | C13H13F2N3OS |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | methyl N-cyano-N'-(4-cyclobutyloxy-3,5-difluorophenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1cc(F)c(OC2CCC2)c(F)c1)NC#N |
| InChI | InChI=1S/C13H13F2N3OS/c1-20-13(17-7-16)18-8-5-10(14)12(11(15)6-8)19-9-3-2-4-9/h5-6,9H,2-4H2,1H3,(H,17,18) |
| InChIKey | QAKTZAYOFLQXET-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|