About N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide
N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide (PubChem CID 169365515) has the molecular formula C11H14BrClN2
and a molecular weight of 289.60 g/mol. Its IUPAC name is N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide.
Molecular Properties
| Compound Name | N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide |
| PubChem CID | 169365515 |
| Molecular Formula | C11H14BrClN2 |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide |
| SMILES | Cc1cc(C)c(/N=C(/N)CCl)c(C)c1Br |
| InChI | InChI=1S/C11H14BrClN2/c1-6-4-7(2)11(8(3)10(6)12)15-9(14)5-13/h4H,5H2,1-3H3,(H2,14,15) |
| InChIKey | NWQDIOMYXMWKTC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide?
The IUPAC name of N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide (CID 169365515) is N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide.
What is the SMILES notation for N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide?
The canonical SMILES for N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide is Cc1cc(C)c(/N=C(/N)CCl)c(C)c1Br.
What is the InChIKey of N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide?
The InChIKey is NWQDIOMYXMWKTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrClN2/c1-6-4-7(2)11(8(3)10(6)12)15-9(14)5-13/h4H,5H2,1-3H3,(H2,14,15).
What are the key properties of N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide?
N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide has a molecular weight of 289.60 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-bromo-2,4,6-trimethylphenyl)-2-chloroethanimidamide is sourced from PubChem (CID 169365515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).