C14H16ClN5 — CID 169366369
2-chloro-N'-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]ethanimidamide (PubChem CID 169366369) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-chloro-N'-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366369 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-chloro-N'-[3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cccc(-c2nnc3n2CCCC3)c1 |
| InChI | InChI=1S/C14H16ClN5/c15-9-12(16)17-11-5-3-4-10(8-11)14-19-18-13-6-1-2-7-20(13)14/h3-5,8H,1-2,6-7,9H2,(H2,16,17) |
| InChIKey | HXUJJMHVFDBTQH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|