C14H8ClF5N2O — CID 169366543
2-chloro-N'-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]ethanimidamide (PubChem CID 169366543) has the molecular formula C14H8ClF5N2O and a molecular weight of 350.67 g/mol. Its IUPAC name is 2-chloro-N'-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366543 |
| Molecular Formula | C14H8ClF5N2O |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-chloro-N'-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cccc(Oc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C14H8ClF5N2O/c15-5-8(21)22-6-2-1-3-7(4-6)23-14-12(19)10(17)9(16)11(18)13(14)20/h1-4H,5H2,(H2,21,22) |
| InChIKey | DXZBPRTYXMAHAZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|