About 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide
2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide (PubChem CID 169366862) has the molecular formula C12H15ClN2O2
and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide.
Molecular Properties
| Compound Name | 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide |
| PubChem CID | 169366862 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide |
| SMILES | CCCc1cc2c(cc1/N=C(/N)CCl)OCO2 |
| InChI | InChI=1S/C12H15ClN2O2/c1-2-3-8-4-10-11(17-7-16-10)5-9(8)15-12(14)6-13/h4-5H,2-3,6-7H2,1H3,(H2,14,15) |
| InChIKey | XRJUCEILWLFLIS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide?
The IUPAC name of 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide (CID 169366862) is 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide.
What is the SMILES notation for 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide?
The canonical SMILES for 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide is CCCc1cc2c(cc1/N=C(/N)CCl)OCO2.
What is the InChIKey of 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide?
The InChIKey is XRJUCEILWLFLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O2/c1-2-3-8-4-10-11(17-7-16-10)5-9(8)15-12(14)6-13/h4-5H,2-3,6-7H2,1H3,(H2,14,15).
What are the key properties of 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide?
2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide has a molecular weight of 254.72 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N'-(6-propyl-1,3-benzodioxol-5-yl)ethanimidamide is sourced from PubChem (CID 169366862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).