C14H17ClN4O — CID 169367117
2-chloro-N'-[4-[(1-ethylpyrazol-4-yl)methoxy]phenyl]ethanimidamide (PubChem CID 169367117) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-chloro-N'-[4-[(1-ethylpyrazol-4-yl)methoxy]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-[(1-ethylpyrazol-4-yl)methoxy]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367117 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-chloro-N'-[4-[(1-ethylpyrazol-4-yl)methoxy]phenyl]ethanimidamide |
| SMILES | CCn1cc(COc2ccc(/N=C(/N)CCl)cc2)cn1 |
| InChI | InChI=1S/C14H17ClN4O/c1-2-19-9-11(8-17-19)10-20-13-5-3-12(4-6-13)18-14(16)7-15/h3-6,8-9H,2,7,10H2,1H3,(H2,16,18) |
| InChIKey | AHGNNUOOGHPNGJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|