C15H21ClN2O2 — CID 169367281
2-chloro-N'-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]ethanimidamide (PubChem CID 169367281) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-chloro-N'-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367281 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-chloro-N'-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]ethanimidamide |
| SMILES | CC1(C)OC(c2ccc(/N=C(/N)CCl)cc2)OC1(C)C |
| InChI | InChI=1S/C15H21ClN2O2/c1-14(2)15(3,4)20-13(19-14)10-5-7-11(8-6-10)18-12(17)9-16/h5-8,13H,9H2,1-4H3,(H2,17,18) |
| InChIKey | CFNSANWAMPHHCK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|