About 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide
2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide (PubChem CID 169367351) has the molecular formula C12H13ClF2N2O
and a molecular weight of 274.70 g/mol. Its IUPAC name is 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide.
Molecular Properties
| Compound Name | 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide |
| PubChem CID | 169367351 |
| Molecular Formula | C12H13ClF2N2O |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(F)c(OC2CCC2)c(F)c1 |
| InChI | InChI=1S/C12H13ClF2N2O/c13-6-11(16)17-7-4-9(14)12(10(15)5-7)18-8-2-1-3-8/h4-5,8H,1-3,6H2,(H2,16,17) |
| InChIKey | JRBQLUQNMMRTGN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide?
The IUPAC name of 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide (CID 169367351) is 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide.
What is the SMILES notation for 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide?
The canonical SMILES for 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide is N/C(CCl)=N/c1cc(F)c(OC2CCC2)c(F)c1.
What is the InChIKey of 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide?
The InChIKey is JRBQLUQNMMRTGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClF2N2O/c13-6-11(16)17-7-4-9(14)12(10(15)5-7)18-8-2-1-3-8/h4-5,8H,1-3,6H2,(H2,16,17).
What are the key properties of 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide?
2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide has a molecular weight of 274.70 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N'-(4-cyclobutyloxy-3,5-difluorophenyl)ethanimidamide is sourced from PubChem (CID 169367351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).