C11H13Cl2N3O — CID 169367851
N-[4-[(1-amino-2-chloroethylidene)amino]-2-chlorophenyl]propanamide (PubChem CID 169367851) has the molecular formula C11H13Cl2N3O and a molecular weight of 274.15 g/mol. Its IUPAC name is N-[4-[(1-amino-2-chloroethylidene)amino]-2-chlorophenyl]propanamide.
| Compound Name | N-[4-[(1-amino-2-chloroethylidene)amino]-2-chlorophenyl]propanamide |
|---|---|
| PubChem CID | 169367851 |
| Molecular Formula | C11H13Cl2N3O |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-[4-[(1-amino-2-chloroethylidene)amino]-2-chlorophenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(/N=C(/N)CCl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O/c1-2-11(17)16-9-4-3-7(5-8(9)13)15-10(14)6-12/h3-5H,2,6H2,1H3,(H2,14,15)(H,16,17) |
| InChIKey | KSJZZBGTQHRMJT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|