C14H10Cl3N3O3S — CID 169368316
8-[(1-amino-2-chloroethylidene)amino]-3,6-dichloro-9H-carbazole-1-sulfonic acid (PubChem CID 169368316) has the molecular formula C14H10Cl3N3O3S and a molecular weight of 406.68 g/mol. Its IUPAC name is 8-[(1-amino-2-chloroethylidene)amino]-3,6-dichloro-9H-carbazole-1-sulfonic acid.
| Compound Name | 8-[(1-amino-2-chloroethylidene)amino]-3,6-dichloro-9H-carbazole-1-sulfonic acid |
|---|---|
| PubChem CID | 169368316 |
| Molecular Formula | C14H10Cl3N3O3S |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 8-[(1-amino-2-chloroethylidene)amino]-3,6-dichloro-9H-carbazole-1-sulfonic acid |
| SMILES | N/C(CCl)=N/c1cc(Cl)cc2c1[nH]c1c(S(=O)(=O)O)cc(Cl)cc12 |
| InChI | InChI=1S/C14H10Cl3N3O3S/c15-5-12(18)19-10-3-6(16)1-8-9-2-7(17)4-11(24(21,22)23)14(9)20-13(8)10/h1-4,20H,5H2,(H2,18,19)(H,21,22,23) |
| InChIKey | PZITUCRCIVXZRY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|