About 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide
2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide (PubChem CID 169369130) has the molecular formula C11H13ClN2O
and a molecular weight of 224.69 g/mol. Its IUPAC name is 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide.
Molecular Properties
| Compound Name | 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide |
| PubChem CID | 169369130 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc2c(c1)CC(O)C2 |
| InChI | InChI=1S/C11H13ClN2O/c12-6-11(13)14-9-2-1-7-4-10(15)5-8(7)3-9/h1-3,10,15H,4-6H2,(H2,13,14) |
| InChIKey | QAYJAVQLYVCPRY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide?
The IUPAC name of 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide (CID 169369130) is 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide.
What is the SMILES notation for 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide?
The canonical SMILES for 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide is N/C(CCl)=N/c1ccc2c(c1)CC(O)C2.
What is the InChIKey of 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide?
The InChIKey is QAYJAVQLYVCPRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O/c12-6-11(13)14-9-2-1-7-4-10(15)5-8(7)3-9/h1-3,10,15H,4-6H2,(H2,13,14).
What are the key properties of 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide?
2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide has a molecular weight of 224.69 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N'-(2-hydroxy-2,3-dihydro-1H-inden-5-yl)ethanimidamide is sourced from PubChem (CID 169369130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).