C19H21ClN2O3S — CID 169371025
N-[4-chloro-2-(piperidine-1-carbonyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 169371025) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is N-[4-chloro-2-(piperidine-1-carbonyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-chloro-2-(piperidine-1-carbonyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169371025 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[4-chloro-2-(piperidine-1-carbonyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H21ClN2O3S/c1-14-5-8-16(9-6-14)26(24,25)21-18-10-7-15(20)13-17(18)19(23)22-11-3-2-4-12-22/h5-10,13,21H,2-4,11-12H2,1H3 |
| InChIKey | RQHBPXSXMFHYSA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |