C16H13N3O2S — CID 169373023
N-(2,4-dicyano-6-methylphenyl)-4-methylbenzenesulfonamide (PubChem CID 169373023) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is N-(2,4-dicyano-6-methylphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2,4-dicyano-6-methylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169373023 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-(2,4-dicyano-6-methylphenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(C)cc(C#N)cc2C#N)cc1 |
| InChI | InChI=1S/C16H13N3O2S/c1-11-3-5-15(6-4-11)22(20,21)19-16-12(2)7-13(9-17)8-14(16)10-18/h3-8,19H,1-2H3 |
| InChIKey | KPWKTMRSIZBDRZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |