C19H23FN2O4S — CID 169373025
tert-butyl N-[5-fluoro-2-[(4-methylphenyl)sulfonylamino]phenyl]-N-methylcarbamate (PubChem CID 169373025) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is tert-butyl N-[5-fluoro-2-[(4-methylphenyl)sulfonylamino]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[5-fluoro-2-[(4-methylphenyl)sulfonylamino]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 169373025 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | tert-butyl N-[5-fluoro-2-[(4-methylphenyl)sulfonylamino]phenyl]-N-methylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(F)cc2N(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-13-6-9-15(10-7-13)27(24,25)21-16-11-8-14(20)12-17(16)22(5)18(23)26-19(2,3)4/h6-12,21H,1-5H3 |
| InChIKey | WLKIPTJALNKNGF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |