C14H11F2NO3S — CID 169373047
N-(2,3-difluoro-6-formylphenyl)-4-methylbenzenesulfonamide (PubChem CID 169373047) has the molecular formula C14H11F2NO3S and a molecular weight of 311.31 g/mol. Its IUPAC name is N-(2,3-difluoro-6-formylphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(2,3-difluoro-6-formylphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169373047 |
| Molecular Formula | C14H11F2NO3S |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(2,3-difluoro-6-formylphenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2c(C=O)ccc(F)c2F)cc1 |
| InChI | InChI=1S/C14H11F2NO3S/c1-9-2-5-11(6-3-9)21(19,20)17-14-10(8-18)4-7-12(15)13(14)16/h2-8,17H,1H3 |
| InChIKey | BNJXKNUDVWLYRH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|