C14H11F3N2O5S — CID 169373053
N-[2-hydroxy-4-nitro-5-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 169373053) has the molecular formula C14H11F3N2O5S and a molecular weight of 376.31 g/mol. Its IUPAC name is N-[2-hydroxy-4-nitro-5-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-hydroxy-4-nitro-5-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169373053 |
| Molecular Formula | C14H11F3N2O5S |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | N-[2-hydroxy-4-nitro-5-(trifluoromethyl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)c([N+](=O)[O-])cc2O)cc1 |
| InChI | InChI=1S/C14H11F3N2O5S/c1-8-2-4-9(5-3-8)25(23,24)18-11-6-10(14(15,16)17)12(19(21)22)7-13(11)20/h2-7,18,20H,1H3 |
| InChIKey | QRUALSODBFRPQC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|