C20H21N5O — CID 169374124
5-dibenzofuran-1-yl-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169374124) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 5-dibenzofuran-1-yl-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-dibenzofuran-1-yl-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169374124 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-dibenzofuran-1-yl-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2cccc3oc4ccccc4c23)C(N)=N1 |
| InChI | InChI=1S/C20H21N5O/c21-18-23-19(22)25(20(24-18)11-4-1-5-12-20)14-8-6-10-16-17(14)13-7-2-3-9-15(13)26-16/h2-3,6-10H,1,4-5,11-12H2,(H4,21,22,23,24) |
| InChIKey | LMEGSABZJXHGSJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |