C17H19F6N5O — CID 169374799
2-[2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 169374799) has the molecular formula C17H19F6N5O and a molecular weight of 423.36 g/mol. Its IUPAC name is 2-[2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 169374799 |
| Molecular Formula | C17H19F6N5O |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[2-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | NC1=NC2(CCCCC2)N(c2ccccc2C(O)(C(F)(F)F)C(F)(F)F)C(N)=N1 |
| InChI | InChI=1S/C17H19F6N5O/c18-16(19,20)15(29,17(21,22)23)10-6-2-3-7-11(10)28-13(25)26-12(24)27-14(28)8-4-1-5-9-14/h2-3,6-7,29H,1,4-5,8-9H2,(H4,24,25,26,27) |
| InChIKey | WDNKOANKNZKHIA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |