C24H27N5O2 — CID 169375282
methyl 3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-2-phenylprop-2-enoate (PubChem CID 169375282) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is methyl 3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-2-phenylprop-2-enoate.
| Compound Name | methyl 3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 169375282 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | methyl 3-[4-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)phenyl]-2-phenylprop-2-enoate |
| SMILES | COC(=O)C(=Cc1ccc(N2C(N)=NC(N)=NC23CCCCC3)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H27N5O2/c1-31-21(30)20(18-8-4-2-5-9-18)16-17-10-12-19(13-11-17)29-23(26)27-22(25)28-24(29)14-6-3-7-15-24/h2,4-5,8-13,16H,3,6-7,14-15H2,1H3,(H4,25,26,27,28) |
| InChIKey | KTOUABDCPJALSZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|