C17H22F3N5O — CID 169376659
5-[4-(2,2,2-trifluoroethoxymethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169376659) has the molecular formula C17H22F3N5O and a molecular weight of 369.39 g/mol. Its IUPAC name is 5-[4-(2,2,2-trifluoroethoxymethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[4-(2,2,2-trifluoroethoxymethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169376659 |
| Molecular Formula | C17H22F3N5O |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 5-[4-(2,2,2-trifluoroethoxymethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2ccc(COCC(F)(F)F)cc2)C(N)=N1 |
| InChI | InChI=1S/C17H22F3N5O/c18-17(19,20)11-26-10-12-4-6-13(7-5-12)25-15(22)23-14(21)24-16(25)8-2-1-3-9-16/h4-7H,1-3,8-11H2,(H4,21,22,23,24) |
| InChIKey | PCFYDDYKFLZSBF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |