C18H24N6O2 — CID 169377231
methyl 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,3-dihydro-1H-indole-2-carboxylate (PubChem CID 169377231) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is methyl 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,3-dihydro-1H-indole-2-carboxylate.
| Compound Name | methyl 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,3-dihydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 169377231 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | methyl 6-(2,4-diamino-1,3,5-triazaspiro[5.5]undeca-1,3-dien-5-yl)-2,3-dihydro-1H-indole-2-carboxylate |
| SMILES | COC(=O)C1Cc2ccc(N3C(N)=NC(N)=NC34CCCCC4)cc2N1 |
| InChI | InChI=1S/C18H24N6O2/c1-26-15(25)14-9-11-5-6-12(10-13(11)21-14)24-17(20)22-16(19)23-18(24)7-3-2-4-8-18/h5-6,10,14,21H,2-4,7-9H2,1H3,(H4,19,20,22,23) |
| InChIKey | CUTCCTDYHJYQGH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |