C18H22F6N6 — CID 169377385
5-[4-(dimethylamino)-3,5-bis(trifluoromethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169377385) has the molecular formula C18H22F6N6 and a molecular weight of 436.40 g/mol. Its IUPAC name is 5-[4-(dimethylamino)-3,5-bis(trifluoromethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[4-(dimethylamino)-3,5-bis(trifluoromethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169377385 |
| Molecular Formula | C18H22F6N6 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 5-[4-(dimethylamino)-3,5-bis(trifluoromethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | CN(C)c1c(C(F)(F)F)cc(N2C(N)=NC(N)=NC23CCCCC3)cc1C(F)(F)F |
| InChI | InChI=1S/C18H22F6N6/c1-29(2)13-11(17(19,20)21)8-10(9-12(13)18(22,23)24)30-15(26)27-14(25)28-16(30)6-4-3-5-7-16/h8-9H,3-7H2,1-2H3,(H4,25,26,27,28) |
| InChIKey | BTMFUHNIKLBTDI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|