C17H19F3N8 — CID 169377528
5-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169377528) has the molecular formula C17H19F3N8 and a molecular weight of 392.39 g/mol. Its IUPAC name is 5-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169377528 |
| Molecular Formula | C17H19F3N8 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 5-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | NC1=NC2(CCCCC2)N(c2cc(C(F)(F)F)ccc2-n2cncn2)C(N)=N1 |
| InChI | InChI=1S/C17H19F3N8/c18-17(19,20)11-4-5-12(27-10-23-9-24-27)13(8-11)28-15(22)25-14(21)26-16(28)6-2-1-3-7-16/h4-5,8-10H,1-3,6-7H2,(H4,21,22,25,26) |
| InChIKey | YPPHAYKNSXWPSV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |