C17H24FN5O2 — CID 169378056
5-[2-(dimethoxymethyl)-3-fluorophenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine (PubChem CID 169378056) has the molecular formula C17H24FN5O2 and a molecular weight of 349.41 g/mol. Its IUPAC name is 5-[2-(dimethoxymethyl)-3-fluorophenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine.
| Compound Name | 5-[2-(dimethoxymethyl)-3-fluorophenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 169378056 |
| Molecular Formula | C17H24FN5O2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 5-[2-(dimethoxymethyl)-3-fluorophenyl]-1,3,5-triazaspiro[5.5]undeca-1,3-diene-2,4-diamine |
| SMILES | COC(OC)c1c(F)cccc1N1C(N)=NC(N)=NC12CCCCC2 |
| InChI | InChI=1S/C17H24FN5O2/c1-24-14(25-2)13-11(18)7-6-8-12(13)23-16(20)21-15(19)22-17(23)9-4-3-5-10-17/h6-8,14H,3-5,9-10H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | MZXKTMAJUNCODJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|