C13H9F3N2 — CID 169381722
N-[(2,3,5-trifluorophenyl)methylideneamino]aniline (PubChem CID 169381722) has the molecular formula C13H9F3N2 and a molecular weight of 250.22 g/mol. Its IUPAC name is N-[(2,3,5-trifluorophenyl)methylideneamino]aniline.
| Compound Name | N-[(2,3,5-trifluorophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 169381722 |
| Molecular Formula | C13H9F3N2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | N-[(2,3,5-trifluorophenyl)methylideneamino]aniline |
| SMILES | Fc1cc(F)c(F)c(C=NNc2ccccc2)c1 |
| InChI | InChI=1S/C13H9F3N2/c14-10-6-9(13(16)12(15)7-10)8-17-18-11-4-2-1-3-5-11/h1-8,18H |
| InChIKey | YTBQVFHNRSYVCA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|