C20H27N3 — CID 169382063
N-[[4-[[butyl(ethyl)amino]methyl]phenyl]methylideneamino]aniline (PubChem CID 169382063) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-[[4-[[butyl(ethyl)amino]methyl]phenyl]methylideneamino]aniline.
| Compound Name | N-[[4-[[butyl(ethyl)amino]methyl]phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169382063 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N-[[4-[[butyl(ethyl)amino]methyl]phenyl]methylideneamino]aniline |
| SMILES | CCCCN(CC)Cc1ccc(C=NNc2ccccc2)cc1 |
| InChI | InChI=1S/C20H27N3/c1-3-5-15-23(4-2)17-19-13-11-18(12-14-19)16-21-22-20-9-7-6-8-10-20/h6-14,16,22H,3-5,15,17H2,1-2H3 |
| InChIKey | LXSVHQCDHNAANF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|