C20H15F3N2O — CID 169382106
N-[[2-[(3,4-difluorophenyl)methoxy]-4-fluorophenyl]methylideneamino]aniline (PubChem CID 169382106) has the molecular formula C20H15F3N2O and a molecular weight of 356.35 g/mol. Its IUPAC name is N-[[2-[(3,4-difluorophenyl)methoxy]-4-fluorophenyl]methylideneamino]aniline.
| Compound Name | N-[[2-[(3,4-difluorophenyl)methoxy]-4-fluorophenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169382106 |
| Molecular Formula | C20H15F3N2O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[[2-[(3,4-difluorophenyl)methoxy]-4-fluorophenyl]methylideneamino]aniline |
| SMILES | Fc1ccc(C=NNc2ccccc2)c(OCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C20H15F3N2O/c21-16-8-7-15(12-24-25-17-4-2-1-3-5-17)20(11-16)26-13-14-6-9-18(22)19(23)10-14/h1-12,25H,13H2 |
| InChIKey | KKERCNJJNYVNHQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|