C18H20N2O — CID 169382151
N-[[2-(cyclopropylmethoxymethyl)phenyl]methylideneamino]aniline (PubChem CID 169382151) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[[2-(cyclopropylmethoxymethyl)phenyl]methylideneamino]aniline.
| Compound Name | N-[[2-(cyclopropylmethoxymethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169382151 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[[2-(cyclopropylmethoxymethyl)phenyl]methylideneamino]aniline |
| SMILES | C(=NNc1ccccc1)c1ccccc1COCC1CC1 |
| InChI | InChI=1S/C18H20N2O/c1-2-8-18(9-3-1)20-19-12-16-6-4-5-7-17(16)14-21-13-15-10-11-15/h1-9,12,15,20H,10-11,13-14H2 |
| InChIKey | XSPOCXDFKIDRBO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|