C13H11BCl2N2O2 — CID 169383884
[2,6-dichloro-3-[(phenylhydrazinylidene)methyl]phenyl]boronic acid (PubChem CID 169383884) has the molecular formula C13H11BCl2N2O2 and a molecular weight of 308.96 g/mol. Its IUPAC name is [2,6-dichloro-3-[(phenylhydrazinylidene)methyl]phenyl]boronic acid.
| Compound Name | [2,6-dichloro-3-[(phenylhydrazinylidene)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 169383884 |
| Molecular Formula | C13H11BCl2N2O2 |
| Molecular Weight | 308.96 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | [2,6-dichloro-3-[(phenylhydrazinylidene)methyl]phenyl]boronic acid |
| SMILES | OB(O)c1c(Cl)ccc(C=NNc2ccccc2)c1Cl |
| InChI | InChI=1S/C13H11BCl2N2O2/c15-11-7-6-9(13(16)12(11)14(19)20)8-17-18-10-4-2-1-3-5-10/h1-8,18-20H |
| InChIKey | FHDDADBNWPXIHN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.96 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|