C15H13F5N2 — CID 169387110
1-[[2-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-2-phenylhydrazine (PubChem CID 169387110) has the molecular formula C15H13F5N2 and a molecular weight of 316.27 g/mol. Its IUPAC name is 1-[[2-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[2-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169387110 |
| Molecular Formula | C15H13F5N2 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[[2-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-2-phenylhydrazine |
| SMILES | FC(F)(F)C(F)(F)c1ccccc1CNNc1ccccc1 |
| InChI | InChI=1S/C15H13F5N2/c16-14(17,15(18,19)20)13-9-5-4-6-11(13)10-21-22-12-7-2-1-3-8-12/h1-9,21-22H,10H2 |
| InChIKey | IETZGBODOZTAEP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|