C29H33N3O4 — CID 169388396
dimethyl 1-phenyl-3-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)pyrazole-4,5-dicarboxylate (PubChem CID 169388396) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is dimethyl 1-phenyl-3-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)pyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-phenyl-3-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)pyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388396 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | dimethyl 1-phenyl-3-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)pyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2cc3c4c(c2)C(C)(C)CCN4CCC3(C)C)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C29H33N3O4/c1-28(2)12-14-31-15-13-29(3,4)21-17-18(16-20(28)24(21)31)23-22(26(33)35-5)25(27(34)36-6)32(30-23)19-10-8-7-9-11-19/h7-11,16-17H,12-15H2,1-6H3 |
| InChIKey | WQSWKWOUJBBMGU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |