C23H22N2O6 — CID 169388517
dimethyl 3-[4-(1,3-dioxan-2-yl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169388517) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is dimethyl 3-[4-(1,3-dioxan-2-yl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-(1,3-dioxan-2-yl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388517 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | dimethyl 3-[4-(1,3-dioxan-2-yl)phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C3OCCCO3)cc2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C23H22N2O6/c1-28-21(26)18-19(15-9-11-16(12-10-15)23-30-13-6-14-31-23)24-25(20(18)22(27)29-2)17-7-4-3-5-8-17/h3-5,7-12,23H,6,13-14H2,1-2H3 |
| InChIKey | WARALOMQLMKCSE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |