C24H24N2O8 — CID 169388819
dimethyl 3-[4-(2-acetyloxyethoxy)-3-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169388819) has the molecular formula C24H24N2O8 and a molecular weight of 468.46 g/mol. Its IUPAC name is dimethyl 3-[4-(2-acetyloxyethoxy)-3-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-(2-acetyloxyethoxy)-3-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388819 |
| Molecular Formula | C24H24N2O8 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | dimethyl 3-[4-(2-acetyloxyethoxy)-3-methoxyphenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OCCOC(C)=O)c(OC)c2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C24H24N2O8/c1-15(27)33-12-13-34-18-11-10-16(14-19(18)30-2)21-20(23(28)31-3)22(24(29)32-4)26(25-21)17-8-6-5-7-9-17/h5-11,14H,12-13H2,1-4H3 |
| InChIKey | HJSFUCOFXBXFCQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 115.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|