C27H32N4O5 — CID 169388969
dimethyl 3-[2-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-phenylpyrazole-4,5-dicarboxylate (PubChem CID 169388969) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is dimethyl 3-[2-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-phenylpyrazole-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 169388969 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | dimethyl 3-[2-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1-phenylpyrazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2OCCCN2CCN(C)CC2)nn(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C27H32N4O5/c1-29-15-17-30(18-16-29)14-9-19-36-22-13-8-7-12-21(22)24-23(26(32)34-2)25(27(33)35-3)31(28-24)20-10-5-4-6-11-20/h4-8,10-13H,9,14-19H2,1-3H3 |
| InChIKey | HZRZTMSZHKMDOA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|