C19H17ClN4O3 — CID 169390987
ethyl 6-amino-4-(3-chloro-4-imidazol-1-ylphenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169390987) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is ethyl 6-amino-4-(3-chloro-4-imidazol-1-ylphenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-(3-chloro-4-imidazol-1-ylphenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169390987 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | ethyl 6-amino-4-(3-chloro-4-imidazol-1-ylphenyl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(-n2ccnc2)c(Cl)c1 |
| InChI | InChI=1S/C19H17ClN4O3/c1-3-26-19(25)16-11(2)27-18(22)13(9-21)17(16)12-4-5-15(14(20)8-12)24-7-6-23-10-24/h4-8,10,17H,3,22H2,1-2H3 |
| InChIKey | DUUOSSXVPMEFPJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |