C22H28BN3O5 — CID 169392325
ethyl 6-amino-4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 169392325) has the molecular formula C22H28BN3O5 and a molecular weight of 425.29 g/mol. Its IUPAC name is ethyl 6-amino-4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169392325 |
| Molecular Formula | C22H28BN3O5 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | ethyl 6-amino-4-[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cc(B2OC(C)(C)C(C)(C)O2)ccc1N |
| InChI | InChI=1S/C22H28BN3O5/c1-7-28-20(27)17-12(2)29-19(26)15(11-24)18(17)14-10-13(8-9-16(14)25)23-30-21(3,4)22(5,6)31-23/h8-10,18H,7,25-26H2,1-6H3 |
| InChIKey | ZSZIUAPETDWWKK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 129.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|