C20H18N4O4 — CID 169392609
ethyl 6-amino-5-cyano-2-methyl-4-(3-pyrazin-2-yloxyphenyl)-4H-pyran-3-carboxylate (PubChem CID 169392609) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is ethyl 6-amino-5-cyano-2-methyl-4-(3-pyrazin-2-yloxyphenyl)-4H-pyran-3-carboxylate.
| Compound Name | ethyl 6-amino-5-cyano-2-methyl-4-(3-pyrazin-2-yloxyphenyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 169392609 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | ethyl 6-amino-5-cyano-2-methyl-4-(3-pyrazin-2-yloxyphenyl)-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1cccc(Oc2cnccn2)c1 |
| InChI | InChI=1S/C20H18N4O4/c1-3-26-20(25)17-12(2)27-19(22)15(10-21)18(17)13-5-4-6-14(9-13)28-16-11-23-7-8-24-16/h4-9,11,18H,3,22H2,1-2H3 |
| InChIKey | CBBMPOXNSWJLEK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |