C16H14BF4N2O3- — CID 169392911
[2-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-3-fluorophenyl]-trifluoroboranuide (PubChem CID 169392911) has the molecular formula C16H14BF4N2O3- and a molecular weight of 369.10 g/mol. Its IUPAC name is [2-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-3-fluorophenyl]-trifluoroboranuide.
| Compound Name | [2-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-3-fluorophenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 169392911 |
| Molecular Formula | C16H14BF4N2O3- |
| Molecular Weight | 369.10 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-(2-amino-3-cyano-5-ethoxycarbonyl-6-methyl-4H-pyran-4-yl)-3-fluorophenyl]-trifluoroboranuide |
| SMILES | CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1c(F)cccc1[B-](F)(F)F |
| InChI | InChI=1S/C16H14BF4N2O3/c1-3-25-16(24)12-8(2)26-15(23)9(7-22)13(12)14-10(17(19,20)21)5-4-6-11(14)18/h4-6,13H,3,23H2,1-2H3/q-1 |
| InChIKey | DHSUZEMTZMUULM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.10 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|