About 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile
2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169393004) has the molecular formula C13H7BrN4O
and a molecular weight of 315.13 g/mol. Its IUPAC name is 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| PubChem CID | 169393004 |
| Molecular Formula | C13H7BrN4O |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccccc1Br |
| InChI | InChI=1S/C13H7BrN4O/c14-10-4-2-1-3-7(10)11-8(5-15)12(17)18-13(19)9(11)6-16/h1-4H,(H3,17,18,19) |
| InChIKey | LEEBAMHGKJHXGJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (CID 169393004) is 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile is N#Cc1c(N)[nH]c(=O)c(C#N)c1-c1ccccc1Br.
What is the InChIKey of 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile?
The InChIKey is LEEBAMHGKJHXGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrN4O/c14-10-4-2-1-3-7(10)11-8(5-15)12(17)18-13(19)9(11)6-16/h1-4H,(H3,17,18,19).
What are the key properties of 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile?
2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile has a molecular weight of 315.13 g/mol, XLogP of 2.13, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(2-bromophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile is sourced from PubChem (CID 169393004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).