C19H19BN4O3 — CID 169393205
2-amino-6-oxo-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169393205) has the molecular formula C19H19BN4O3 and a molecular weight of 362.20 g/mol. Its IUPAC name is 2-amino-6-oxo-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-oxo-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169393205 |
| Molecular Formula | C19H19BN4O3 |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-amino-6-oxo-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-pyridine-3,5-dicarbonitrile |
| SMILES | CC1(C)OB(c2ccccc2-c2c(C#N)c(N)[nH]c(=O)c2C#N)OC1(C)C |
| InChI | InChI=1S/C19H19BN4O3/c1-18(2)19(3,4)27-20(26-18)14-8-6-5-7-11(14)15-12(9-21)16(23)24-17(25)13(15)10-22/h5-8H,1-4H3,(H3,23,24,25) |
| InChIKey | JPRWKMXLWGMKDO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|