C17H16N4O2 — CID 169393597
2-amino-6-oxo-4-[4-(propoxymethyl)phenyl]-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169393597) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-amino-6-oxo-4-[4-(propoxymethyl)phenyl]-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-oxo-4-[4-(propoxymethyl)phenyl]-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169393597 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-amino-6-oxo-4-[4-(propoxymethyl)phenyl]-1H-pyridine-3,5-dicarbonitrile |
| SMILES | CCCOCc1ccc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C17H16N4O2/c1-2-7-23-10-11-3-5-12(6-4-11)15-13(8-18)16(20)21-17(22)14(15)9-19/h3-6H,2,7,10H2,1H3,(H3,20,21,22) |
| InChIKey | PSCKAEAMDZARIN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|