C16H10BrIN4O2 — CID 169395120
2-amino-4-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395120) has the molecular formula C16H10BrIN4O2 and a molecular weight of 497.09 g/mol. Its IUPAC name is 2-amino-4-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395120 |
| Molecular Formula | C16H10BrIN4O2 |
| Molecular Weight | 497.09 g/mol |
| Exact Mass | 495.90 |
| IUPAC Name | 2-amino-4-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | C=CCOc1c(I)cc(Br)cc1-c1c(C#N)c(N)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C16H10BrIN4O2/c1-2-3-24-14-9(4-8(17)5-12(14)18)13-10(6-19)15(21)22-16(23)11(13)7-20/h2,4-5H,1,3H2,(H3,21,22,23) |
| InChIKey | MBGBGBFYGCARJK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.09 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|