C15H7FN4O — CID 169395735
2-amino-4-(4-ethynyl-2-fluorophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 169395735) has the molecular formula C15H7FN4O and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-amino-4-(4-ethynyl-2-fluorophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(4-ethynyl-2-fluorophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169395735 |
| Molecular Formula | C15H7FN4O |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-amino-4-(4-ethynyl-2-fluorophenyl)-6-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | C#Cc1ccc(-c2c(C#N)c(N)[nH]c(=O)c2C#N)c(F)c1 |
| InChI | InChI=1S/C15H7FN4O/c1-2-8-3-4-9(12(16)5-8)13-10(6-17)14(19)20-15(21)11(13)7-18/h1,3-5H,(H3,19,20,21) |
| InChIKey | OZINMBSCBQMLCM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|