About 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile
2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile (PubChem CID 169396291) has the molecular formula C11H6ClF2N5
and a molecular weight of 281.65 g/mol. Its IUPAC name is 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile |
| PubChem CID | 169396291 |
| Molecular Formula | C11H6ClF2N5 |
| Molecular Weight | 281.65 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1-c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C11H6ClF2N5/c12-5-1-2-6(13)8(14)7(5)9-4(3-15)10(16)19-11(17)18-9/h1-2H,(H4,16,17,18,19) |
| InChIKey | IIMGESKXKYZUAO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile?
The IUPAC name of 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile (CID 169396291) is 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile.
What is the SMILES notation for 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile?
The canonical SMILES for 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile is N#Cc1c(N)nc(N)nc1-c1c(Cl)ccc(F)c1F.
What is the InChIKey of 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile?
The InChIKey is IIMGESKXKYZUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClF2N5/c12-5-1-2-6(13)8(14)7(5)9-4(3-15)10(16)19-11(17)18-9/h1-2H,(H4,16,17,18,19).
What are the key properties of 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile?
2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile has a molecular weight of 281.65 g/mol, XLogP of 2.11, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-6-(6-chloro-2,3-difluorophenyl)pyrimidine-5-carbonitrile is sourced from PubChem (CID 169396291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).