C16H16N6 — CID 169397169
2,4-diamino-6-(1-prop-2-enyl-2,3-dihydroindol-5-yl)pyrimidine-5-carbonitrile (PubChem CID 169397169) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 2,4-diamino-6-(1-prop-2-enyl-2,3-dihydroindol-5-yl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(1-prop-2-enyl-2,3-dihydroindol-5-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169397169 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2,4-diamino-6-(1-prop-2-enyl-2,3-dihydroindol-5-yl)pyrimidine-5-carbonitrile |
| SMILES | C=CCN1CCc2cc(-c3nc(N)nc(N)c3C#N)ccc21 |
| InChI | InChI=1S/C16H16N6/c1-2-6-22-7-5-10-8-11(3-4-13(10)22)14-12(9-17)15(18)21-16(19)20-14/h2-4,8H,1,5-7H2,(H4,18,19,20,21) |
| InChIKey | AXAGCKAPFWTDNC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|