C20H20BrN3O4 — CID 169400742
ethyl 5-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2H-triazole-4-carboxylate (PubChem CID 169400742) has the molecular formula C20H20BrN3O4 and a molecular weight of 446.30 g/mol. Its IUPAC name is ethyl 5-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400742 |
| Molecular Formula | C20H20BrN3O4 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | ethyl 5-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1ccc(OCc2ccc(Br)cc2)c(OCC)c1 |
| InChI | InChI=1S/C20H20BrN3O4/c1-3-26-17-11-14(18-19(23-24-22-18)20(25)27-4-2)7-10-16(17)28-12-13-5-8-15(21)9-6-13/h5-11H,3-4,12H2,1-2H3,(H,22,23,24) |
| InChIKey | JKWLKHDLBHTUHJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |